1H-Purine-2,6-dione,3,9-dihydro-8-methyl- structure
|
Common Name | 1H-Purine-2,6-dione,3,9-dihydro-8-methyl- | ||
|---|---|---|---|---|
| CAS Number | 17338-96-4 | Molecular Weight | 166.13700 | |
| Density | 1.522g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-methyl-3,7-dihydropurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.13700 |
| Exact Mass | 166.04900 |
| PSA | 94.40000 |
| Index of Refraction | 1.882 |
| InChIKey | RTAPDZBZLSXHQQ-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-methyl xanthine |
| 3,7-dihydro-8-methyl-1H-purine-2,6-dione |
| 8-Methyl-3,7-dihydro-purin-2,6-dion |
| 8-methyl-9h-purine-2,6-diol |
| 8-methyl-3,7(9)-dihydro-purine-2,6-dione |
| 2,6-Dihydroxy-8-methylpurine |
| 8-Methyl-xanthin |
| 8-methylxantine |