2-Propenal, 3- (4-nitrophenyl)- structure
|
Common Name | 2-Propenal, 3- (4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1734-79-8 | Molecular Weight | 177.157 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 311.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | 140-143 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 151.6±13.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(4-Nitrophenyl)acrylaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.6±17.0 °C at 760 mmHg |
| Melting Point | 140-143 °C(lit.) |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.157 |
| Flash Point | 151.6±13.7 °C |
| Exact Mass | 177.042587 |
| PSA | 62.89000 |
| LogP | 1.90 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | ALGQVMMYDWQDEC-OWOJBTEDSA-N |
| SMILES | O=CC=Cc1ccc([N+](=O)[O-])cc1 |
| Storage condition | Refrigerator (+4°C) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GD6650000 |
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Reactivity at the substrate activation site of yeast pyruvate decarboxylase: inhibition by distortion of domain interactions.
Biochemistry 37(5) , 1245-55, (1998) The residue C221 on pyruvate decarboxylase (EC. 4.1.1.1) from Saccharomyces cerevisiae has been shown to be the site where the substrate activation cascade is triggered [Baburina et al. (1994) Biochem... |
|
|
Genotoxicity of p-nitrocinnamaldehyde and related alpha, beta-unsaturated carbonyl compounds in two bacterial assays.
Mutagenesis 6(4) , 261-9, (1991) Seventeen cinnamaldehydes, cinnamic acids, 2-furylacroleins and related compounds were tested in the Salmonella preincubation reversion assay and in the SOS chromotest. Of eight compounds containing n... |
| MFCD00007379 |
| 2-Propenal, 3- (4-nitrophenyl)- |
| 3-(4-Nitrophenyl)-2-propenal |
| (2E)-3-(4-Nitrophenyl)acrylaldehyde |
| 2-Propenal, 3-(4-nitrophenyl)-, (2E)- |
| (2E)-3-(4-Nitrophenyl)-2-propenal |
| 4-NITROCINNAMALDEHYDE |
| trans-4-Nitrocinnamaldehyde |
| EINECS 217-076-8 |