Tyrosylleucine structure
|
Common Name | Tyrosylleucine | ||
|---|---|---|---|---|
| CAS Number | 17355-10-1 | Molecular Weight | 294.35 | |
| Density | 1.218g/cm3 | Boiling Point | 575.9ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1ºC | |
Use of TyrosylleucineTyrosylleucine (Tyr-Leu, YL), an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
| Name | Tyr-Leu |
|---|---|
| Synonym | More Synonyms |
| Description | Tyrosylleucine (Tyr-Leu, YL), an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Tyrosylleucine (YL), administered orally, intracerebroventricularly, or intraperitoneally exhibits a potent antidepressant-like activity in the forced swim and tail suspension tests in naïve mice[1]. Animal Model: Male ddY mice (24-27 g)[1] Dosage: 0.1-30 mg/kg, i.p.; 0.1-1.0 nmol/mouse, i.c.v.; 30-100 mg/kg, p.o. Administration: Administered orally, intracerebroventricularly, or intraperitoneally Result: Decreased immobility time after intraperitoneal (1-30 mg/kg) and intracerebroventricular (0.3-1 nmol/mouse) administrations in the FST. Exhibited a potent antidepressant-like activity in the forced swim and tail suspension tests in naïve mice. |
| References |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 575.9ºC at 760 mmHg |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 |
| Flash Point | 302.1ºC |
| Exact Mass | 294.15800 |
| PSA | 112.65000 |
| LogP | 1.96870 |
| Vapour Pressure | 4.2E-14mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | AUEJLPRZGVVDNU-STQMWFEESA-N |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-L-Tyrosyl-L-leucin |
| TYR-LEU |
| L-Leucine,N-L-tyrosyl |
| N-L-tyrosyl-L-leucine |
| tyrosylleucine |
| L-Tyrosyl-L-leucine |
| L-Tyrosyl-L-leucin |
| H-TYR-LEU-OH |
| L-tyrosine-L-leucine |
| TYR-LEU CRYSTALLINE |