Tyrosylleucine TFA
Tyrosylleucine TFA structure
|
Common Name | Tyrosylleucine TFA | ||
|---|---|---|---|---|
| CAS Number | 66852-01-5 | Molecular Weight | 408.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23F3N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyrosylleucine TFATyrosylleucine (Tyr-Leu, YL) TFA, an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Tyr-L-Leu-OH trifluoroacetate |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Tyrosylleucine (Tyr-Leu, YL) TFA, an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Tyrosylleucine (Tyr-Leu, YL) increases the amount of cells expressing c-Fos, a marker for neuronal activity, in the dentate gyrus of the hippocampus[1]. |
| In Vivo | Tyrosylleucine (Tyr-Leu, YL) dose-dependently exhibits potent anxiolytic-like activity (0.1-1 mg/kg, i.p.)[2]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23F3N2O6 |
|---|---|
| Molecular Weight | 408.37 |
| Exact Mass | 408.15100 |
| PSA | 149.95000 |
| LogP | 2.60200 |
| InChIKey | ITCLJBVMTNXDJY-QNTKWALQSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O.O=C(O)C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:61-90-5
CAS#:60-18-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: The English name of L-Tyr-L-Leu-OH trifluoroacetate is L-Tyr-L-Leu-OH trifluoroacetate. |
| Q: What is the polar surface area (PSA) of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: Polar surface area (PSA) of L-Tyr-L-Leu-OH trifluoroacetate is 149.95000. |
| Q: What is the molecular weight of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: Molecular weight of L-Tyr-L-Leu-OH trifluoroacetate is 408.37. |
| Q: What is the SMILES notation of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: SMILES notation of L-Tyr-L-Leu-OH trifluoroacetate is CC(C)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O.O=C(O)C(F)(F)F. |
| Q: What is the CAS number of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: CAS number of L-Tyr-L-Leu-OH trifluoroacetate is 66852-01-5. |
| Q: What is the LogP of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: LogP of L-Tyr-L-Leu-OH trifluoroacetate is 2.60200. |
| Q: What is the molecular formula of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: Molecular formula of L-Tyr-L-Leu-OH trifluoroacetate is C17H23F3N2O6. |
| Q: What is the Chinese name of 66852-01-5? |
| A: Chinese name of 66852-01-5 is Tyrosylleucine TFA. |
| Q: What is the InChIKey of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: InChIKey of L-Tyr-L-Leu-OH trifluoroacetate is ITCLJBVMTNXDJY-QNTKWALQSA-N. |
| Q: What are the downstream products of L-Tyr-L-Leu-OH trifluoroacetate? |
| A: Related downstream products(CAS) of L-Tyr-L-Leu-OH trifluoroacetate: 61-90-5;60-18-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |