Tyrosylleucine TFA structure
|
Common Name | Tyrosylleucine TFA | ||
|---|---|---|---|---|
| CAS Number | 66852-01-5 | Molecular Weight | 408.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23F3N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyrosylleucine TFATyrosylleucine (Tyr-Leu, YL) TFA, an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
| Name | L-Tyr-L-Leu-OH trifluoroacetate |
|---|
| Description | Tyrosylleucine (Tyr-Leu, YL) TFA, an orally active dipeptide, exhibits a potent antidepressant-like activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Tyrosylleucine (Tyr-Leu, YL) increases the amount of cells expressing c-Fos, a marker for neuronal activity, in the dentate gyrus of the hippocampus[1]. |
| In Vivo | Tyrosylleucine (Tyr-Leu, YL) dose-dependently exhibits potent anxiolytic-like activity (0.1-1 mg/kg, i.p.)[2]. |
| References |
| Molecular Formula | C17H23F3N2O6 |
|---|---|
| Molecular Weight | 408.37 |
| Exact Mass | 408.15100 |
| PSA | 149.95000 |
| LogP | 2.60200 |
| InChIKey | ITCLJBVMTNXDJY-QNTKWALQSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O.O=C(O)C(F)(F)F |
| Precursor 0 | |
|---|---|
| DownStream 2 | |