H-Phe-Tyr-OH structure
|
Common Name | H-Phe-Tyr-OH | ||
|---|---|---|---|---|
| CAS Number | 17355-18-9 | Molecular Weight | 328.36200 | |
| Density | 1.3g/cm3 | Boiling Point | 642.2ºC at 760mmHg | |
| Molecular Formula | C18H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.2ºC | |
| Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 642.2ºC at 760mmHg |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.36200 |
| Flash Point | 342.2ºC |
| Exact Mass | 328.14200 |
| PSA | 112.65000 |
| LogP | 2.16530 |
| Vapour Pressure | 2.27E-17mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | FSXRLASFHBWESK-HOTGVXAUSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| Storage condition | -20C |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-Phe-Tyr-OH |
| L-Tyrosine,L-phenylalanyl |
| L-Phe-L-Tyr |
| L-phenylalanyl-L-tyrosine |
| phenylalanyltyrosine |
| dipeptide phenylalanyl-tyrosine |