4-(Trifluoromethyl)phenylthiourea structure
|
Common Name | 4-(Trifluoromethyl)phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 1736-72-7 | Molecular Weight | 220.21500 | |
| Density | 1.337g/cm3 | Boiling Point | 203.4ºC at 760mmHg | |
| Molecular Formula | C8H7F3N2S | Melting Point | 142-146 °C | |
| MSDS | Chinese USA | Flash Point | 102.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[4-(trifluoromethyl)phenyl]-2-thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 203.4ºC at 760mmHg |
| Melting Point | 142-146 °C |
| Molecular Formula | C8H7F3N2S |
| Molecular Weight | 220.21500 |
| Flash Point | 102.1ºC |
| Exact Mass | 220.02800 |
| PSA | 70.14000 |
| LogP | 3.13420 |
| InChIKey | OWTDDZMFRLUBQI-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R22 |
| Safety Phrases | S26-S36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2930909090 |
|
~99%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: NOVO NORDISK A/S Patent: WO2004/2480 A1, 2004 ; Location in patent: Page/Page column 150 ; WO 2004/002480 A1 |
|
~%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: WO2007/5785 A1, ; Page/Page column 29-30 ; |
|
~12%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: THE BOARD OF TRUSTEES OF THE LELAND STANFORD JUNIOR UNIVERSITY; AUCKLAND UNISERVICES LIMITED Patent: WO2009/114552 A1, 2009 ; Location in patent: Page/Page column 149 ; |
|
~88%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: Rasmussen, C. R.; Villani, F. J.; Weaner, L. E.; Reynolds, B. E.; Hood, A. R.; et al. Synthesis, 1988 , # 6 p. 456 - 459 |
|
~%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 40, # 12 p. 1901 - 1905 |
|
~%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 14, # 16 p. 5678 - 5682 |
|
~%
4-(Trifluoromet... CAS#:1736-72-7 |
| Literature: Synthetic Communications, , vol. 42, # 7 p. 951 - 958 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00041189 |
| N-[4-(Trifluoromethyl)phenyl]thiourea |
| [4-(trifluoromethyl)phenyl]thiourea |
| 1-(4-(Trifluoromethyl)phenyl)thiourea |