ETIROXATE structure
|
Common Name | ETIROXATE | ||
|---|---|---|---|---|
| CAS Number | 17365-01-4 | Molecular Weight | 818.95 | |
| Density | 2.321g/cm3 | Boiling Point | 563.7ºC at 760 mmHg | |
| Molecular Formula | C18H17I4NO4 | Melting Point | 149-151ºC | |
| MSDS | N/A | Flash Point | 294.7ºC | |
Use of ETIROXATEEtiroxate (CG-635) is a lipid lowing compound which can be used for hyperlipoproteinemia research[1]. |
| Name | ethyl 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Etiroxate (CG-635) is a lipid lowing compound which can be used for hyperlipoproteinemia research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.321g/cm3 |
|---|---|
| Boiling Point | 563.7ºC at 760 mmHg |
| Melting Point | 149-151ºC |
| Molecular Formula | C18H17I4NO4 |
| Molecular Weight | 818.95 |
| Flash Point | 294.7ºC |
| Exact Mass | 818.73400 |
| PSA | 81.78000 |
| LogP | 6.12620 |
| Vapour Pressure | 2.6E-13mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | LWZCMKGGFONJPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(N)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
| Etiroxato |
| Etiroxatum [INN-Latin] |
| Etiroxatum |
| Etiroxato [INN-Spanish] |
| UNII-0S3LDN5P7H |
| Etiroxate |