(R)-Piperazine-1,2,4-tricarboxylic acid 1,4-di-tert-butyl ester
Modify Date: 2025-08-25 19:44:48
(R)-Piperazine-1,2,4-tricarboxylic acid 1,4-di-tert-butyl ester structure
|
Common Name | (R)-Piperazine-1,2,4-tricarboxylic acid 1,4-di-tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 173774-48-6 | Molecular Weight | 330.37700 | |
| Density | 1.201 g/cm3 | Boiling Point | 443.888ºC at 760 mmHg | |
| Molecular Formula | C15H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.256ºC | |
| Name | (R)-1,4-Bis(tert-butoxycarbonyl)piperazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201 g/cm3 |
|---|---|
| Boiling Point | 443.888ºC at 760 mmHg |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.37700 |
| Flash Point | 222.256ºC |
| Exact Mass | 330.17900 |
| PSA | 96.38000 |
| LogP | 1.80320 |
| Index of Refraction | 1.503 |
| InChIKey | IIZGWFQKLVCLLA-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(C(=O)O)C1 |
| HS Code | 2933599090 |
|---|
CAS#:192330-11-3
CAS#:24424-99-5
CAS#:637027-24-8| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |