4-Boc-piperazine-2-carboxylic acid structure
|
Common Name | 4-Boc-piperazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 192330-11-3 | Molecular Weight | 230.261 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 371.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H18N2O4 | Melting Point | 231-239ºC | |
| MSDS | Chinese USA | Flash Point | 178.6±26.5 °C | |
| Name | (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.8±37.0 °C at 760 mmHg |
| Melting Point | 231-239ºC |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.261 |
| Flash Point | 178.6±26.5 °C |
| Exact Mass | 230.126663 |
| PSA | 78.87000 |
| LogP | 0.26 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | YRYAXQJXMBETAT-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C(=O)O)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36;R43 |
| Safety Phrases | S26-S36/37 |
| HS Code | 2933599090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02179099 |
| r-bpca |
| 4-Boc-piperazine-2-carboxylic acid |
| 4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid |
| 1,3-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) ester |