Benzyl L-leucinate structure
|
Common Name | Benzyl L-leucinate | ||
|---|---|---|---|---|
| CAS Number | 1738-69-8 | Molecular Weight | 221.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl L-leucinate |
|---|
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29500 |
| Exact Mass | 221.14200 |
| PSA | 52.32000 |
| LogP | 2.80350 |
| Vapour Pressure | 0.000987mmHg at 25°C |
| InChIKey | MBRRYUQWSOODEO-LBPRGKRZSA-N |
| SMILES | CC(C)CC(N)C(=O)OCc1ccccc1 |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |