Gly-OBzl.TsOH structure
|
Common Name | Gly-OBzl.TsOH | ||
|---|---|---|---|---|
| CAS Number | 1738-76-7 | Molecular Weight | 337.391 | |
| Density | N/A | Boiling Point | 245.5ºC at 760 mmHg | |
| Molecular Formula | C16H19NO5S | Melting Point | 132-134 °C | |
| MSDS | USA | Flash Point | 110.3ºC | |
Use of Gly-OBzl.TsOHH-Gly-OBzl.TosOH is a Glycine (HY-Y0966) derivative[1]. |
| Name | Glycine benzyl ester p-toluenesulfonate salt |
|---|---|
| Synonym | More Synonyms |
| Description | H-Gly-OBzl.TosOH is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 245.5ºC at 760 mmHg |
|---|---|
| Melting Point | 132-134 °C |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.391 |
| Flash Point | 110.3ºC |
| Exact Mass | 337.098389 |
| PSA | 115.07000 |
| LogP | 3.71130 |
| Vapour Pressure | 0.0285mmHg at 25°C |
| InChIKey | WJKJXKRHMUXQSL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NCC(=O)OCc1ccccc1 |
| Storage condition | −20°C |
| Water Solubility | methanol: 0.1 g/mL, clear |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922499990 |
|
~10%
Gly-OBzl.TsOH CAS#:1738-76-7 |
| Literature: Brimble, Margaret A.; Trotter, Nicholas S.; Harris, Paul W.R.; Sieg, Frank Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 2 p. 519 - 532 |
|
~99%
Gly-OBzl.TsOH CAS#:1738-76-7 |
| Literature: Arai, Isamu; Muramatsu, Ichiro Journal of Organic Chemistry, 1983 , vol. 48, # 1 p. 121 - 123 |
|
~%
Gly-OBzl.TsOH CAS#:1738-76-7 |
| Literature: US4513009 A1, ; US 4513009 A |
|
~75%
Gly-OBzl.TsOH CAS#:1738-76-7 |
| Literature: Yamazaki; Sakamoto; Suzuri; Doi; Nakazawa; Kobayashi Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 16 p. 1870 - 1875 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| H-Gly-Obzl-Tosoh |
| Gly-OBzl.TsOH |
| EINECS 217-094-6 |
| Aminoacetic acid benzyl ester toluene-4-sulfonic acid salt |
| Benzyl glycinate 4-methylbenzenesulfonate (1:1) |
| H-Gly-OBzl·Tos-OH |
| Benzyl glycinate p-toluenesulfonate |
| Benzyl glycinate p-toluenesulfonate salt |
| Glycine Benzyl Ester p-Toluenesulfonate |
| Glycine, phenylmethyl ester, 4-methylbenzenesulfonate (1:1) |
| MFCD00035425 |
| H-Gly-OBzl·TosOH |