Z-Leu-ONp structure
|
Common Name | Z-Leu-ONp | ||
|---|---|---|---|---|
| CAS Number | 1738-87-0 | Molecular Weight | 386.398 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 561.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.2±28.7 °C | |
| Name | (S)-4-Nitrophenyl 2-(((benzyloxy)carbonyl)amino)-4-methylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.3±45.0 °C at 760 mmHg |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.398 |
| Flash Point | 293.2±28.7 °C |
| Exact Mass | 386.147797 |
| PSA | 110.45000 |
| LogP | 4.90 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | UALXQWNUXKECJD-SFHVURJKSA-N |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~87%
Z-Leu-ONp CAS#:1738-87-0 |
| Literature: Kim, Sunggak; Ko, Young Kwan Journal of the Chemical Society, Chemical Communications, 1985 , # 8 p. 473 |
|
~%
Z-Leu-ONp CAS#:1738-87-0 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 5 p. 560 - 565 |
|
~%
Z-Leu-ONp CAS#:1738-87-0 |
| Literature: Helvetica Chimica Acta, , vol. 40, p. 373,385 |
|
~%
Z-Leu-ONp CAS#:1738-87-0 |
| Literature: Helvetica Chimica Acta, , vol. 40, p. 373,385 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbobenzoxy-L-leucine p-nitrophenyl ester |
| 4-Nitrophenyl N-[(benzyloxy)carbonyl]-L-leucinate |
| (4-nitrophenyl) (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| Benzyloxycarbonyl-L-leucine p-nitrophenyl ester |
| L-Leucine, N-[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester |
| N-Carbobenzoxy-L-leucine p-nitrophenyl ester |
| MFCD00024656 |
| N-(Benzyloxycarbonyl)-L-leucine p-nitrophenyl ester |
| EINECS 217-098-8 |
| Z-Leu-Onp |
| Benzyloxycarbonyl-L-leucine p-nitrophenylester |