2-chloro-1-(1H-indol-3-yl)propan-1-one structure
|
Common Name | 2-chloro-1-(1H-indol-3-yl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 17380-07-3 | Molecular Weight | 207.65600 | |
| Density | 1.284g/cm3 | Boiling Point | 378.1ºC at 760mmHg | |
| Molecular Formula | C11H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | 2-chloro-1-(1H-indol-3-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 378.1ºC at 760mmHg |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.65600 |
| Flash Point | 182.5ºC |
| Exact Mass | 207.04500 |
| PSA | 32.86000 |
| LogP | 2.97790 |
| Vapour Pressure | 6.42E-06mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ITKRRBMAMUDWMP-UHFFFAOYSA-N |
| SMILES | CC(Cl)C(=O)c1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Chloropropionyl)indol |
| 2-Chloro-1-(1H-indol-3-yl)-propan-1-one |
| 2-chloro-1-indol-3-yl-propan-1-one |
| 3-(2-Chlorpropionyl)-indol |
| HMS2712D20 |