2-chloro-1-(1H-indol-3-yl)-2-phenylethanone structure
|
Common Name | 2-chloro-1-(1H-indol-3-yl)-2-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 42883-45-4 | Molecular Weight | 269.72600 | |
| Density | 1.307g/cm3 | Boiling Point | 463.4ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234ºC | |
| Name | 2-chloro-1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 463.4ºC at 760 mmHg |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Flash Point | 234ºC |
| Exact Mass | 269.06100 |
| PSA | 32.86000 |
| LogP | 4.33070 |
| Index of Refraction | 1.679 |
| InChIKey | ASZBJIFVTIEZFN-UHFFFAOYSA-N |
| SMILES | O=C(c1c[nH]c2ccccc12)C(Cl)c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~54%
2-chloro-1-(1H-... CAS#:42883-45-4 |
| Literature: KATHOLIEKE UNIVERSITEIT LEUVEN; BARDIOT, Dorothée; CARLENS, Gunter; DALLMEIER, Kai; KAPTEIN, Suzanne; McNAUGHTON, Michael; MARCHAND, Arnaud; NEYTS, Johan; SMETS, Wim Patent: WO2013/45516 A1, 2013 ; Location in patent: Page/Page column 128; 132 ; |
|
~%
2-chloro-1-(1H-... CAS#:42883-45-4 |
| Literature: Upjohn Co. Patent: US2814624 , 1954 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlor-1-indol-3-yl-2-phenyl-aethanon |
| 2-chloro-1-indol-3-yl-2-phenyl-ethanone |
| 2-Chloro-1-(1H-indol-3-yl)-2-phenyl-ethanone |