Isocarapanaubine structure
|
Common Name | Isocarapanaubine | ||
|---|---|---|---|---|
| CAS Number | 17391-09-2 | Molecular Weight | 428.478 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 599.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H28N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.4±30.1 °C | |
Use of Isocarapanaubine7-Isocarapanaubine is an indole that can be isolated from Rauwolfi vomitoria[1]. |
| Name | Methyl (7α,19α,20α)-10,11-dimethoxy-19-methyl-2-oxoformosanan-16- carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Isocarapanaubine is an indole that can be isolated from Rauwolfi vomitoria[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 599.5±50.0 °C at 760 mmHg |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.478 |
| Flash Point | 316.4±30.1 °C |
| Exact Mass | 428.194733 |
| PSA | 86.33000 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | QIZNWMMOECVGAP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)Nc5cc(OC)c(OC)cc54)C3CC12 |
| Hazard Codes | Xi |
|---|
| isocarapanaubine |
| Rauvanin Oxindol A |
| Carapanaubin |
| Carapanaubine |
| Rauvanin Oxindol B |
| Isocarapanaubin |
| isoreserpiline oxindole-A |
| Methyl (7α,19α,20α)-10,11-dimethoxy-19-methyl-2-oxoformosanan-16-carboxylate |
| Spiro[3H-indole-3,6'(10'H)-[1H]pyrano[3,4-f]indolizine]-4'-carboxylic acid, 1,2,4'a,5',5'a,7',8',10'a-octahydro-5,6-dimethoxy-1'-methyl-2-oxo-, methyl ester, (1'S,3S,4a'S,5a'S,10a'S)- |
| Cavapanaubin |