(S)-(-)-2-(3 5-DI-TERT-BUTYLSALICYLIDEN& structure
|
Common Name | (S)-(-)-2-(3 5-DI-TERT-BUTYLSALICYLIDEN& | ||
|---|---|---|---|---|
| CAS Number | 174022-08-3 | Molecular Weight | 333.50800 | |
| Density | 0.95g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C21H35NO2 | Melting Point | 88-92ºC(lit.) | |
| MSDS | N/A | Flash Point | 273.9ºC | |
| Name | 2-[(E)-{[(2S)-1-Hydroxy-3,3-dimethyl-2-butanyl]imino}methyl]-4,6- bis(2-methyl-2-propanyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Melting Point | 88-92ºC(lit.) |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.50800 |
| Flash Point | 273.9ºC |
| Exact Mass | 333.26700 |
| PSA | 52.82000 |
| LogP | 4.81310 |
| Vapour Pressure | 6.89E-08mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | QBLAJFNGSINFEB-QGZVFWFLSA-N |
| SMILES | CC(C)(C)c1cc(C=NC(CO)C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|
~97%
(S)-(-)-2-(3 5-... CAS#:174022-08-3 |
| Literature: Shiels, Rebecca A.; Venkatasubbaiah, Krishnan; Jones, Christopher W. Advanced Synthesis and Catalysis, 2008 , vol. 350, # 17 p. 2823 - 2834 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD03093880 |
| (S)-(-)-2-(3,5-di-tert-butylsalicilidenamino)-3,3-dimethyl-1-butanol |
| 2,4-bis(1,1-dimethylethyl)-6-({[(1S)-1-hydroxymethyl-2,2-dimethylpropyl]imino}methyl)phenol |
| (S)-2,4-di-tert-butyl-6-<(1-hydroxymethyl-2,2-dimethylpropylimino)methyl>phenol |
| (S)-(-)-2-(3,5-di-tert-butylsalicylideneamino)-3,3-dimethyl-1-butanol |
| 2,4-bis (trifluoromethyl)-pyrimidine-5-carboxylic acid |
| S-2-(N-3,5-di-tert-butylsalicylidene)amino-3,3-dimethyl-1-butanol |
| Bolm's ligand |