2-(3-Chlorophenoxy)-2-methylpropanoic acid
Modify Date: 2025-08-31 17:49:33
2-(3-Chlorophenoxy)-2-methylpropanoic acid structure
|
Common Name | 2-(3-Chlorophenoxy)-2-methylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 17413-73-9 | Molecular Weight | 214.645 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 324.1±17.0 °C at 760 mmHg | |
| Molecular Formula | C10H11ClO3 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 149.8±20.9 °C | |
| Name | 2-(3-chlorophenoxy)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.1±17.0 °C at 760 mmHg |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.645 |
| Flash Point | 149.8±20.9 °C |
| Exact Mass | 214.039673 |
| PSA | 46.53000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | PZBIVIXQLIVFHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1cccc(Cl)c1)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propanoic acid, 2-(3-chlorophenoxy)-2-methyl- |
| 2-(3-Chlorophenoxy)-2-methylpropanoic acid |