butyl 2-(1H-indol-3-yl)acetate structure
|
Common Name | butyl 2-(1H-indol-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 17429-10-6 | Molecular Weight | 231.29000 | |
| Density | 1.132g/cm3 | Boiling Point | 378.2ºC at 760mmHg | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | butyl 2-(1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 378.2ºC at 760mmHg |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29000 |
| Flash Point | 182.5ºC |
| Exact Mass | 231.12600 |
| PSA | 42.09000 |
| LogP | 3.05370 |
| Vapour Pressure | 6.39E-06mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | GRFMAWCPVKWLFE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
butyl 2-(1H-ind... CAS#:17429-10-6 |
| Literature: Redemann et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 2957 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| indol-3-yl-acetic acid butyl ester |
| Butyl 1H-indole-3-acetate |
| butyl 1h-indol-3-ylacetate |
| Indol-3-yl-essigsaeure-butylester |
| EINECS 241-455-7 |