pentyl 2-(1H-indol-3-yl)acetate structure
|
Common Name | pentyl 2-(1H-indol-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 551-42-8 | Molecular Weight | 245.31700 | |
| Density | 1.111g/cm3 | Boiling Point | 390.9ºC at 760 mmHg | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2ºC | |
| Name | pentyl 2-(1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760 mmHg |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.31700 |
| Flash Point | 190.2ºC |
| Exact Mass | 245.14200 |
| PSA | 42.09000 |
| LogP | 3.44380 |
| Index of Refraction | 1.575 |
| InChIKey | CFPUZDKNJDQMLV-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)Cc1c[nH]c2ccccc12 |
|
~%
pentyl 2-(1H-in... CAS#:551-42-8 |
| Literature: Redemann et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 2957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| indol-3-yl-acetic acid pentyl ester |
| pentyl 1h-indol-3-ylacetate |
| Indol-3-yl-essigsaeure-pentylester |