1-(3-Trifluoromethylphenyl)imidazoline-2-thione structure
|
Common Name | 1-(3-Trifluoromethylphenyl)imidazoline-2-thione | ||
|---|---|---|---|---|
| CAS Number | 17452-08-3 | Molecular Weight | 244.23600 | |
| Density | 1.47g/cm3 | Boiling Point | 294ºC at 760mmHg | |
| Molecular Formula | C10H7F3N2S | Melting Point | 157 °C | |
| MSDS | N/A | Flash Point | 131.6ºC | |
| Name | 1-(3-Trifluoromethylphenyl)imidazoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 294ºC at 760mmHg |
| Melting Point | 157 °C |
| Molecular Formula | C10H7F3N2S |
| Molecular Weight | 244.23600 |
| Flash Point | 131.6ºC |
| Exact Mass | 244.02800 |
| PSA | 52.81000 |
| LogP | 3.55370 |
| Vapour Pressure | 0.00166mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | FQMZFHKIYYCCAX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(-n2cc[nH]c2=S)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3-(Trifluoromethyl)phenyl)-1H-imidazole-2(3H)-thione |
| 3-[3-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
| MFCD00041202 |