4-METHYL-5-(2-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-METHYL-5-(2-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 174574-08-4 | Molecular Weight | 205.27900 | |
| Density | 1.25g/cm3 | Boiling Point | 291.2ºC at 760 mmHg | |
| Molecular Formula | C10H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 4-methyl-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 291.2ºC at 760 mmHg |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.27900 |
| Flash Point | 129.9ºC |
| Exact Mass | 205.06700 |
| PSA | 69.51000 |
| LogP | 2.07920 |
| Vapour Pressure | 0.00197mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | FRSXXJAMKPUGFF-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1n[nH]c(=S)n1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |