Z-D-Phe-Pro-OH
Z-D-Phe-Pro-OH structure
|
Common Name | Z-D-Phe-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 17460-56-9 | Molecular Weight | 396.43600 | |
| Density | 1.291g/cm3 | Boiling Point | 669.6ºC at 760mmHg | |
| Molecular Formula | C22H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.8ºC | |
Summary: z-d-phe-pro-oh (Z-D-Phe-Pro-OH, CAS 17460-56-9) is a compound with molecular formula C22H24N2O5 and molecular weight 396.43600. Storage conditions are 2-8°C, sealed, and dry. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | z-d-phe-pro-oh |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 669.6ºC at 760mmHg |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.43600 |
| Flash Point | 358.8ºC |
| Exact Mass | 396.16900 |
| PSA | 95.94000 |
| LogP | 2.92850 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | SLQMUASKUOLVIO-MOPGFXCFSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:7531-52-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| CBZ-D-Phe-Pro-OH |
| Z-Phe-L-Pro |
| benzyloxycarbonylphenylalanylproline |
| N-benzyloxycarbonyl-L-phenylalanyl-L-proline |
| Z-PHENYLALANINE-D-PROLINE |
| N-Benzyloxycarbonyl-D-phenylalanlyproline |
| Cbz-L-Phe-L-Pro-OH |
| Z-Phe-Pro-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of z-d-phe-pro-oh? |
| A: Molecular formula of z-d-phe-pro-oh is C22H24N2O5. |
| Q: What is the SMILES notation of z-d-phe-pro-oh? |
| A: SMILES notation of z-d-phe-pro-oh is O=C(NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O)OCc1ccccc1. |
| Q: What is the Chinese name of 17460-56-9? |
| A: Chinese name of 17460-56-9 is 17460-56-9. |
| Q: What is the LogP of z-d-phe-pro-oh? |
| A: LogP of z-d-phe-pro-oh is 2.92850. |
| Q: What is the polar surface area (PSA) of z-d-phe-pro-oh? |
| A: Polar surface area (PSA) of z-d-phe-pro-oh is 95.94000. |
| Q: What is the CAS number of z-d-phe-pro-oh? |
| A: CAS number of z-d-phe-pro-oh is 17460-56-9. |
| Q: What is the molecular weight of z-d-phe-pro-oh? |
| A: Molecular weight of z-d-phe-pro-oh is 396.43600. |
| Q: What is the boiling point of z-d-phe-pro-oh? |
| A: Boiling point of z-d-phe-pro-oh is 669.6ºC at 760mmHg. |
| Q: What is the InChIKey of z-d-phe-pro-oh? |
| A: InChIKey of z-d-phe-pro-oh is SLQMUASKUOLVIO-MOPGFXCFSA-N. |
| Q: What are the downstream products of z-d-phe-pro-oh? |
| A: Related downstream products(CAS) of z-d-phe-pro-oh: 7531-52-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |