REVERSIN 205 structure
|
Common Name | REVERSIN 205 | ||
|---|---|---|---|---|
| CAS Number | 174630-05-8 | Molecular Weight | 798.91900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H58N4O12 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of REVERSIN 205Reversin 205 ([Boc-Glu(Obzl)]2-Lys-Ome) is a P-glycoprotein (ABCB1) inhibitor. Reversin 205 is a peptide chemosensitizer[1]. |
| Name | methyl (2S)-2,6-bis[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]hexanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Reversin 205 ([Boc-Glu(Obzl)]2-Lys-Ome) is a P-glycoprotein (ABCB1) inhibitor. Reversin 205 is a peptide chemosensitizer[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C41H58N4O12 |
|---|---|
| Molecular Weight | 798.91900 |
| Exact Mass | 798.40500 |
| PSA | 227.72000 |
| LogP | 6.85390 |
| InChIKey | BRVAQYBFHAIYLQ-CPCREDONSA-N |
| SMILES | COC(=O)C(CCCCNC(=O)C(CCC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)NC(=O)C(CCC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| [Boc-Glu(Obzl)]2-Lys-Ome |
| Reversin 205 |