AG-205 structure
|
Common Name | AG-205 | ||
|---|---|---|---|---|
| CAS Number | 442656-02-2 | Molecular Weight | 454.97600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23ClN6OS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of AG-205(rac)-AG-205 is a potent inhibitor of progesterone receptor membrane component 1 (Pgrmc1) that induces genes involved in sterol synthesis, including the INSIG1 protein, which forms a complex with PGRMC1. (rac)-AG-205 prevents neuronal resistance to hypoxic ischaemia by blocking NF-kB signalling and activation of the BDNF/PI3K/AKT pathway[1]. |
| Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | (rac)-AG-205 is a potent inhibitor of progesterone receptor membrane component 1 (Pgrmc1) that induces genes involved in sterol synthesis, including the INSIG1 protein, which forms a complex with PGRMC1. (rac)-AG-205 prevents neuronal resistance to hypoxic ischaemia by blocking NF-kB signalling and activation of the BDNF/PI3K/AKT pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H23ClN6OS |
|---|---|
| Molecular Weight | 454.97600 |
| Exact Mass | 454.13400 |
| PSA | 92.45000 |
| LogP | 3.55360 |
| InChIKey | GJNBAISSZRNGTM-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)CSc1nnnn1-c1ccc(Cl)cc1 |
| ag-205 |