Ro 3-5940 structure
|
Common Name | Ro 3-5940 | ||
|---|---|---|---|---|
| CAS Number | 17469-40-8 | Molecular Weight | 256.68600 | |
| Density | 1.244g/cm3 | Boiling Point | 308.6ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.5ºC | |
| Name | l-5-hydroxytryptophan hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 308.6ºC at 760 mmHg |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.68600 |
| Flash Point | 140.5ºC |
| Exact Mass | 256.06100 |
| PSA | 99.34000 |
| LogP | 2.33020 |
| Vapour Pressure | 0.000673mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | FVXSIINOEZOYDN-FVGYRXGTSA-N |
| SMILES | Cl.NC(Cc1c[nH]c2ccc(O)cc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-5-HTP HCL |
| 5-Hydroxy-L-Tryptophan,hydroxhloride |
| 5-HYDROXY-L-TRYPTOPHAN,HYDROCHLORIDE |