4-[(4-chlorophenyl)methylideneamino]phenol structure
|
Common Name | 4-[(4-chlorophenyl)methylideneamino]phenol | ||
|---|---|---|---|---|
| CAS Number | 1749-05-9 | Molecular Weight | 231.67800 | |
| Density | 1.18g/cm3 | Boiling Point | 400.5ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | 4-[(4-chlorobenzylidene)amino]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 400.5ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.67800 |
| Flash Point | 196ºC |
| Exact Mass | 231.04500 |
| PSA | 32.59000 |
| LogP | 3.79620 |
| Vapour Pressure | 5.49E-07mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FHNNJCYVULKFDO-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Cc2ccc(Cl)cc2)cc1 |
|
~99%
4-[(4-chlorophe... CAS#:1749-05-9 |
| Literature: Schmeyers, Jens; Toda, Fumio; Boy, Juergen; Kaupp, Gerd Journal of the Chemical Society. Perkin Transactions 2, 1998 , # 4 p. 989 - 993 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Hydroxy-4'-chlorbenzanilid |
| 4-Hydroxy-benzoesaeure-<4-chlor-anilid> |
| 4-Oxybenz-4-chloranilid |
| 4'-hydroxy-4-chlorobenzylideneaniline |