2-amino-3,5-dibromo-6-fluorobenzoic acid structure
|
Common Name | 2-amino-3,5-dibromo-6-fluorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 175135-10-1 | Molecular Weight | 312.91900 | |
| Density | 2.222g/cm3 | Boiling Point | 355.9ºC at 760 mmHg | |
| Molecular Formula | C7H4Br2FNO2 | Melting Point | 235ºC | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 2-amino-3,5-dibromo-6-fluorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.222g/cm3 |
|---|---|
| Boiling Point | 355.9ºC at 760 mmHg |
| Melting Point | 235ºC |
| Molecular Formula | C7H4Br2FNO2 |
| Molecular Weight | 312.91900 |
| Flash Point | 169.1ºC |
| Exact Mass | 310.85900 |
| PSA | 63.32000 |
| LogP | 3.21230 |
| Vapour Pressure | 1.11E-05mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | DHWCACOUGDPIBD-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Br)c(F)c1C(=O)O |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 22-26-36/37/39 |
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD00042156 |
| 3,5-Dibromo-6-fluoroanthranilic acid |