4-(3,4-Difluorophenyl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(3,4-Difluorophenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 175135-32-7 | Molecular Weight | 212.21900 | |
| Density | 1.432 g/cm3 | Boiling Point | 361.8ºC at 760 mmHg | |
| Molecular Formula | C9H6F2N2S | Melting Point | 121-125ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-4-(3,4-difluorophenyl)thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432 g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760 mmHg |
| Melting Point | 121-125ºC(lit.) |
| Molecular Formula | C9H6F2N2S |
| Molecular Weight | 212.21900 |
| Flash Point | 172.6ºC |
| Exact Mass | 212.02200 |
| PSA | 67.15000 |
| LogP | 3.25170 |
| Vapour Pressure | 6.36E-07mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | NDCSJUJQMRFHEX-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934100090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00052876 |
| 4-(3,4-Difluorophenyl)thiazol-2-amine |
| 4-(3,4-Difluorophenyl)-1,3-thiazol-2-amine |