4,5-dichloro-2-(2-fluorobenzyl)pyridazine-3(2h)-one structure
|
Common Name | 4,5-dichloro-2-(2-fluorobenzyl)pyridazine-3(2h)-one | ||
|---|---|---|---|---|
| CAS Number | 175135-46-3 | Molecular Weight | 273.09000 | |
| Density | 1.46g/cm3 | Boiling Point | 338.9ºC at 760 mmHg | |
| Molecular Formula | C11H7Cl2FN2O | Melting Point | 110ºC | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | 4,5-dichloro-2-[(2-fluorophenyl)methyl]pyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 338.9ºC at 760 mmHg |
| Melting Point | 110ºC |
| Molecular Formula | C11H7Cl2FN2O |
| Molecular Weight | 273.09000 |
| Flash Point | 158.8ºC |
| Exact Mass | 271.99200 |
| PSA | 34.89000 |
| LogP | 2.73750 |
| Vapour Pressure | 9.5E-05mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | KXXLLZDAGSQFED-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(Cl)cnn1Cc1ccccc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00067775 |
| 4,5-Dichloro-2-(2-fluorobenzyl)pyridazine-3(2H)-one |