4-(4-fluorobenzyloxy)-3-nitroacetophenone structure
|
Common Name | 4-(4-fluorobenzyloxy)-3-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 175136-24-0 | Molecular Weight | 289.25800 | |
| Density | 1.304g/cm3 | Boiling Point | 430.7ºC at 760mmHg | |
| Molecular Formula | C15H12FNO4 | Melting Point | 105-107°C | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | 1-[4-[(4-fluorophenyl)methoxy]-3-nitrophenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 430.7ºC at 760mmHg |
| Melting Point | 105-107°C |
| Molecular Formula | C15H12FNO4 |
| Molecular Weight | 289.25800 |
| Flash Point | 214.3ºC |
| Exact Mass | 289.07500 |
| PSA | 72.12000 |
| LogP | 4.03870 |
| Vapour Pressure | 1.27E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XMYCVHFGYFJOJX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCc2ccc(F)cc2)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-{4-[(4-fluorophenyl)methoxy]-3-nitrophenyl}ethanone |
| fluorobenzyloxynitrophenylethanone |
| HMS547M02 |
| 4'-(4-Fluorobenzyloxy)-3'-nitroacetophenone |
| MFCD00173872 |