1-[6-(TERT-BUTYL)-1,1-DIMETHYL-2,3-DIHYDRO-1H-INDEN-4-YL]ETHAN-1-ONE OXIME
![1-[6-(TERT-BUTYL)-1,1-DIMETHYL-2,3-DIHYDRO-1H-INDEN-4-YL]ETHAN-1-ONE OXIME Structure](https://image.chemsrc.com/caspic/131/175136-27-3.png)
1-[6-(TERT-BUTYL)-1,1-DIMETHYL-2,3-DIHYDRO-1H-INDEN-4-YL]ETHAN-1-ONE OXIME structure
|
Common Name | 1-[6-(TERT-BUTYL)-1,1-DIMETHYL-2,3-DIHYDRO-1H-INDEN-4-YL]ETHAN-1-ONE OXIME | ||
|---|---|---|---|---|
| CAS Number | 175136-27-3 | Molecular Weight | 259.38600 | |
| Density | 1.01g/cm3 | Boiling Point | 356.3ºC at 760 mmHg | |
| Molecular Formula | C17H25NO | Melting Point | 208ºC | |
| MSDS | N/A | Flash Point | 223.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 356.3ºC at 760 mmHg |
| Melting Point | 208ºC |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.38600 |
| Flash Point | 223.3ºC |
| Exact Mass | 259.19400 |
| PSA | 32.59000 |
| LogP | 4.40610 |
| Vapour Pressure | 1.07E-05mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | GXCYRUOTOFUODM-WOJGMQOQSA-N |
| SMILES | CC(=NO)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2928000090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: InChIKey of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is GXCYRUOTOFUODM-WOJGMQOQSA-N. |
| Q: What is the LogP of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: LogP of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 4.40610. |
| Q: What is the molecular weight of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: Molecular weight of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 259.38600. |
| Q: What is the boiling point of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: Boiling point of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 356.3ºC at 760 mmHg. |
| Q: What is the SMILES notation of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: SMILES notation of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is CC(=NO)c1cc(C(C)(C)C)cc2c1CCC2(C)C. |
| Q: What is the molecular formula of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: Molecular formula of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is C17H25NO. |
| Q: What is the polar surface area (PSA) of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: Polar surface area (PSA) of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 32.59000. |
| Q: What is the melting point of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: Melting point of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 208ºC. |
| Q: What is the English name of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: The English name of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine. |
| Q: What is the CAS number of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine? |
| A: CAS number of N-[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylidene]hydroxylamine is 175136-27-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |