1,1-Dimethyl-6-tert-butyl-indan
1,1-Dimethyl-6-tert-butyl-indan structure
|
Common Name | 1,1-Dimethyl-6-tert-butyl-indan | ||
|---|---|---|---|---|
| CAS Number | 3605-31-0 | Molecular Weight | 202.33500 | |
| Density | 0.904g/cm3 | Boiling Point | 242.9ºC at 760mmHg | |
| Molecular Formula | C15H22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.904g/cm3 |
|---|---|
| Boiling Point | 242.9ºC at 760mmHg |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.33500 |
| Flash Point | 94.1ºC |
| Exact Mass | 202.17200 |
| LogP | 4.20790 |
| Index of Refraction | 1.503 |
| InChIKey | ZGPWHILODVHWKJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)CC2 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2902909090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 5 | |
CAS#:78-79-5
CAS#:61813-34-1
CAS#:507-20-0
CAS#:4912-92-9
CAS#:72390-27-3
CAS#:2550-26-7
CAS#:65170-86-7
CAS#:13171-00-1
CAS#:1211-99-0
CAS#:102296-26-4
CAS#:102296-45-7
CAS#:102296-44-6![1-[6-(TERT-BUTYL)-1,1-DIMETHYL-2,3-DIHYDRO-1H-INDEN-4-YL]ETHAN-1-ONE OXIME structure](https://image.chemsrc.com/caspic/131/175136-27-3.png)
CAS#:175136-27-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-dimethyl-6-tert-butylindane |
| 2,3-Dihydro-1,1-dimethyl-6-(1,1-dimethylethyl)-1H-indene |
| EINECS 222-765-1 |
| Indan,6-tert-butyl-1,1-dimethyl |
| 1,1-dimethyl-6-t-butylindane |
| 1,1-Dimethyl-6-tert-butylindan |
| 1H-Indene,2,3-dihydro-1,1-dimethyl-6-(1,1-dimethylethyl) |
| 6-tert-butyl-1,1-dimethylindane |
| 1,1-Dimethyl-6-(1,1-dimethylethyl)indane |
| 6-(tert-Butyl)-1,1-dimethylindan |
| 1H-Indene,6-(1,1-dimethylethyl)-2,3-dihydro-1,1-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: Related downstream products(CAS) of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene: 102296-26-4;13171-00-1;102296-45-7;102296-44-6;175136-27-3. |
| Q: What is the Chinese name of 3605-31-0? |
| A: Chinese name of 3605-31-0 is 3605-31-0. |
| Q: What is the SMILES notation of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: SMILES notation of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is CC(C)(C)c1ccc2c(c1)C(C)(C)CC2. |
| Q: What is the boiling point of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: Boiling point of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is 242.9ºC at 760mmHg. |
| Q: What are the upstream materials of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: Related upstream materials(CAS) of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene: 78-79-5;61813-34-1;507-20-0;4912-92-9;72390-27-3;2550-26-7;65170-86-7;13171-00-1;1211-99-0. |
| Q: What is the LogP of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: LogP of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is 4.20790. |
| Q: What is the English name of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: The English name of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene. |
| Q: What is the molecular weight of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: Molecular weight of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is 202.33500. |
| Q: What is the InChIKey of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: InChIKey of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is ZGPWHILODVHWKJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene? |
| A: Molecular formula of 5-tert-butyl-3,3-dimethyl-1,2-dihydroindene is C15H22. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |