(2,2-DIMETHYL-1-PYRROLIDIN-1-YLMETHYL-PROPYL)-METHYL-CARBAMICACIDBENZYLESTER structure
|
Common Name | (2,2-DIMETHYL-1-PYRROLIDIN-1-YLMETHYL-PROPYL)-METHYL-CARBAMICACIDBENZYLESTER | ||
|---|---|---|---|---|
| CAS Number | 175136-70-6 | Molecular Weight | 258.37900 | |
| Density | 1.083g/cm3 | Boiling Point | 389ºC at 760mmHg | |
| Molecular Formula | C16H18OS | Melting Point | 108ºC | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | (2,3,4,5,6-pentamethylphenyl)-thiophen-2-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760mmHg |
| Melting Point | 108ºC |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.37900 |
| Flash Point | 189.1ºC |
| Exact Mass | 258.10800 |
| PSA | 45.31000 |
| LogP | 4.52110 |
| Vapour Pressure | 2.94E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | ZGEZTRBQIJWTJL-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(C(=O)c2cccs2)c(C)c1C |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| (2,3,4,5,6-Pentamethylphenyl)(2-thienyl)methanone |
| HMS549L04 |
| 2-(Pentamethylbenzoyl)thiophene |