2,4-Diamino-6-(4-fluorophenyl)pyrimidine
2,4-Diamino-6-(4-fluorophenyl)pyrimidine structure
|
Common Name | 2,4-Diamino-6-(4-fluorophenyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 175137-25-4 | Molecular Weight | 204.20400 | |
| Density | 1.361g/cm3 | Boiling Point | 493.9ºC at 760mmHg | |
| Molecular Formula | C10H9FN4 | Melting Point | 164ºC | |
| MSDS | Chinese USA | Flash Point | 252.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Diamino-6-(4-fluorophenyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 493.9ºC at 760mmHg |
| Melting Point | 164ºC |
| Molecular Formula | C10H9FN4 |
| Molecular Weight | 204.20400 |
| Flash Point | 252.5ºC |
| Exact Mass | 204.08100 |
| PSA | 77.82000 |
| LogP | 2.60950 |
| Vapour Pressure | 7.66E-06mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | UJHDGCSPZQBXEB-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccc(F)cc2)nc(N)n1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933599090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Binding affinity to Neisseria meningitidis wild type apo heme oxygenase expressed in ...
Source: ChEMBL
Target: Bacteriophytochrome heme oxygenase
External Id: CHEMBL3881262
|
|
Name: Binding affinity to Pseudomonas aeruginosa MPAO1 wild type apo heme oxygenase by spec...
Source: ChEMBL
Target: Biliverdin-producing heme oxygenase
External Id: CHEMBL3881263
|
|
Name: Antimicrobial activity against Pseudomonas aeruginosa MPAO1 after 10 hrs
Source: ChEMBL
Target: Pseudomonas aeruginosa
External Id: CHEMBL3881279
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00052076 |
| 6-(4-fluorophenyl)pyrimidine-2,4-diamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: InChIKey of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is UJHDGCSPZQBXEB-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,4-Diamino-6-(4-fluorophenyl)pyrimidine have? |
| A: English synonyms of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine: MFCD00052076, 6-(4-fluorophenyl)pyrimidine-2,4-diamine. |
| Q: What is the molecular formula of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: Molecular formula of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is C10H9FN4. |
| Q: What is the CAS number of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: CAS number of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is 175137-25-4. |
| Q: What is the molecular weight of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: Molecular weight of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is 204.20400. |
| Q: What is the SMILES notation of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: SMILES notation of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is Nc1cc(-c2ccc(F)cc2)nc(N)n1. |
| Q: What is the safety information for 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: Safety information for 2,4-Diamino-6-(4-fluorophenyl)pyrimidine: 26-36/37/39. |
| Q: What is the LogP of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: LogP of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is 2.60950. |
| Q: What is the polar surface area (PSA) of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: Polar surface area (PSA) of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is 77.82000. |
| Q: What is the melting point of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine? |
| A: Melting point of 2,4-Diamino-6-(4-fluorophenyl)pyrimidine is 164ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |