Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate structure
|
Common Name | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175137-27-6 | Molecular Weight | 240.567 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 324.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClF3N2O2 | Melting Point | 253-254 °C | |
| MSDS | Chinese USA | Flash Point | 150.3±27.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.9±42.0 °C at 760 mmHg |
| Melting Point | 253-254 °C |
| Molecular Formula | C7H4ClF3N2O2 |
| Molecular Weight | 240.567 |
| Flash Point | 150.3±27.9 °C |
| Exact Mass | 239.991333 |
| PSA | 52.08000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | VLUBJYUOPNGBOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cnc(Cl)nc1C(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S23 |
| RIDADR | UN 2810 6.1 / PGIII |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-4-trifluoromethyl-pyrimidine-5-carboxylic acid methyl ester |
| MFCD00068146 |
| 5-Pyrimidinecarboxylic acid, 2-chloro-4-(trifluoromethyl)-, methyl ester |
| Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| Methyl 2-chloro-4-(trifluoromethyl)-5-pyrimidinecarboxylate |