2'-Amino-3-phthalimid-1-ylpropiophenone structure
|
Common Name | 2'-Amino-3-phthalimid-1-ylpropiophenone | ||
|---|---|---|---|---|
| CAS Number | 17515-32-1 | Molecular Weight | 294.30500 | |
| Density | 1.347g/cm3 | Boiling Point | 512.4ºC at 760mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | 2-[3-(2-aminophenyl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 512.4ºC at 760mmHg |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Flash Point | 263.7ºC |
| Exact Mass | 294.10000 |
| PSA | 80.47000 |
| LogP | 2.65690 |
| Vapour Pressure | 1.3E-10mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | RQZRDXVYNVKYRN-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)CCN1C(=O)c2ccccc2C1=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2925190090 |
|
~%
2'-Amino-3-phth... CAS#:17515-32-1 |
| Literature: Zeitschrift fuer Naturforschung, , vol. 8b, p. 454,461 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-[3-(2-amino-phenyl)-3-oxo-propyl]-phthalimide |
| aminophenyloxopropylisoindoledione |