2-(Benzoyloxy)-N,N,N-trimethylethanaminium iodide structure
|
Common Name | 2-(Benzoyloxy)-N,N,N-trimethylethanaminium iodide | ||
|---|---|---|---|---|
| CAS Number | 17518-43-3 | Molecular Weight | 335.181 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18INO2 | Melting Point | 244-247°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(Benzoyloxy)-N,N,N-trimethylethanaminium iodideBenzoylcholine Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Benzoylcholine Iodide |
|---|---|
| Synonym | More Synonyms |
| Description | Benzoylcholine Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 244-247°C |
|---|---|
| Molecular Formula | C12H18INO2 |
| Molecular Weight | 335.181 |
| Exact Mass | 335.038208 |
| PSA | 26.30000 |
| InChIKey | XILQCEGWGBSDSH-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCOC(=O)c1ccccc1.[I-] |
| Storage condition | −20°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00038726 |
| Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, iodide |
| 2-benzoyloxyethyl(trimethyl)azanium,iodide |
| Ethanaminium, 2- (benzoyloxy)-N,N,N-trimethyl-, iodide |
| EINECS 241-517-3 |
| 2-(Benzoyloxy)-N,N,N-trimethylethanaminium iodide |
| Ethanaminium, 2-(benzoyloxy)-N,N,N-trimethyl-, iodide (1:1) |