n-[3,5-bis(trifluoromethyl)benzenesulfonyl]-l-methionyl hydrazide structure
|
Common Name | n-[3,5-bis(trifluoromethyl)benzenesulfonyl]-l-methionyl hydrazide | ||
|---|---|---|---|---|
| CAS Number | 175202-22-9 | Molecular Weight | 439.39700 | |
| Density | 1.479g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15F6N3O3S2 | Melting Point | 192-195°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | n-[3,5-bis(trifluoromethyl)benzenesulphonyl]-l-methionyl hydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Melting Point | 192-195°C |
| Molecular Formula | C13H15F6N3O3S2 |
| Molecular Weight | 439.39700 |
| Exact Mass | 439.04600 |
| PSA | 134.97000 |
| LogP | 4.67700 |
| Index of Refraction | 1.502 |
| InChIKey | SXEIAYCCOIRYQN-JTQLQIEISA-N |
| SMILES | CSCCC(NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)NN |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD00084900 |