4-methoxy-6-methyl-5-nitro-2-(trifluoromethyl)quinoline structure
|
Common Name | 4-methoxy-6-methyl-5-nitro-2-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 175203-62-0 | Molecular Weight | 286.20700 | |
| Density | 1.49g/cm3 | Boiling Point | 485.3ºC at 760mmHg | |
| Molecular Formula | C12H9F3N2O3 | Melting Point | 181-183ºC | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 4-methoxy-6-methyl-5-nitro-2-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760mmHg |
| Melting Point | 181-183ºC |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.20700 |
| Flash Point | 247.3ºC |
| Exact Mass | 286.05700 |
| PSA | 67.94000 |
| LogP | 4.00200 |
| Vapour Pressure | 3.12E-10mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | JXZITCZYZVYHHV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(F)(F)F)nc2ccc(C)c([N+](=O)[O-])c12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 22-36/37/39 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms555j17 |