6-Trifluoromethoxy-4-quinolinol structure
|
Common Name | 6-Trifluoromethoxy-4-quinolinol | ||
|---|---|---|---|---|
| CAS Number | 175203-87-9 | Molecular Weight | 229.155 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 301.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F3NO2 | Melting Point | 233-236ºC | |
| MSDS | N/A | Flash Point | 136.3±26.5 °C | |
| Name | 6-(Trifluoromethoxy)quinolin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.7±37.0 °C at 760 mmHg |
| Melting Point | 233-236ºC |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.155 |
| Flash Point | 136.3±26.5 °C |
| Exact Mass | 229.035065 |
| PSA | 42.35000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | LFCAVZDSLWEEOX-UHFFFAOYSA-N |
| SMILES | O=c1cc[nH]c2ccc(OC(F)(F)F)cc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(Trifluoromethoxy)quinolin-4-ol |
| 6-Trifluoromethoxy-4-quinolinol |
| MFCD00219858 |
| 6-(Trifluoromethoxy)-4-quinolinol |
| 6-(trifluoromethoxy)-1H-quinolin-4-one |