6-Trifluoromethoxy-4-quinolinol
6-Trifluoromethoxy-4-quinolinol structure
|
Common Name | 6-Trifluoromethoxy-4-quinolinol | ||
|---|---|---|---|---|
| CAS Number | 175203-87-9 | Molecular Weight | 229.155 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 301.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F3NO2 | Melting Point | 233-236ºC | |
| MSDS | N/A | Flash Point | 136.3±26.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Trifluoromethoxy)quinolin-4-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.7±37.0 °C at 760 mmHg |
| Melting Point | 233-236ºC |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.155 |
| Flash Point | 136.3±26.5 °C |
| Exact Mass | 229.035065 |
| PSA | 42.35000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | LFCAVZDSLWEEOX-UHFFFAOYSA-N |
| SMILES | O=c1cc[nH]c2ccc(OC(F)(F)F)cc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:927800-55-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-(Trifluoromethoxy)quinolin-4-ol |
| 6-Trifluoromethoxy-4-quinolinol |
| MFCD00219858 |
| 6-(Trifluoromethoxy)-4-quinolinol |
| 6-(trifluoromethoxy)-1H-quinolin-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Molecular formula of 6-(Trifluoromethoxy)quinolin-4-ol is C10H6F3NO2. |
| Q: What is the molecular weight of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Molecular weight of 6-(Trifluoromethoxy)quinolin-4-ol is 229.155. |
| Q: What is the melting point of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Melting point of 6-(Trifluoromethoxy)quinolin-4-ol is 233-236ºC. |
| Q: What is the SMILES notation of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: SMILES notation of 6-(Trifluoromethoxy)quinolin-4-ol is O=c1cc[nH]c2ccc(OC(F)(F)F)cc12. |
| Q: What is the boiling point of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Boiling point of 6-(Trifluoromethoxy)quinolin-4-ol is 301.7±37.0 °C at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Polar surface area (PSA) of 6-(Trifluoromethoxy)quinolin-4-ol is 42.35000. |
| Q: What are the downstream products of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: Related downstream products(CAS) of 6-(Trifluoromethoxy)quinolin-4-ol: 927800-55-3. |
| Q: What is the LogP of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: LogP of 6-(Trifluoromethoxy)quinolin-4-ol is 3.27. |
| Q: What English synonyms does 6-(Trifluoromethoxy)quinolin-4-ol have? |
| A: English synonyms of 6-(Trifluoromethoxy)quinolin-4-ol: 6-(Trifluoromethoxy)quinolin-4-ol, 6-Trifluoromethoxy-4-quinolinol, MFCD00219858, 6-(Trifluoromethoxy)-4-quinolinol, 6-(trifluoromethoxy)-1H-quinolin-4-one. |
| Q: What is the CAS number of 6-(Trifluoromethoxy)quinolin-4-ol? |
| A: CAS number of 6-(Trifluoromethoxy)quinolin-4-ol is 175203-87-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |