Silthiofam structure
|
Common Name | Silthiofam | ||
|---|---|---|---|---|
| CAS Number | 175217-20-6 | Molecular Weight | 267.46200 | |
| Density | 1.01g/cm3 | Boiling Point | 303.2ºC at 760mmHg | |
| Molecular Formula | C13H21NOSSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 137.2ºC | |
Use of SilthiofamSilthiofam is very effective against Ggt, and recently it has been widely used for the control of take-all in China. Gaeumannomyces graminis var. tritici (Ggt) causes Wheat take-all. |
| Name | silthiofam |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 303.2ºC at 760mmHg |
| Molecular Formula | C13H21NOSSi |
| Molecular Weight | 267.46200 |
| Flash Point | 137.2ºC |
| Exact Mass | 267.11100 |
| PSA | 57.34000 |
| LogP | 3.21680 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | MXMXHPPIGKYTAR-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)c1c([Si](C)(C)C)sc(C)c1C |
| Storage condition | 2-8°C |
|
Simultaneous determination of sixteen amide fungicides in vegetables and fruits by dispersive solid phase extraction and liquid chromatography-tandem mass spectrometry.
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 989 , 11-20, (2015) A modified quick, easy, cheap, effective, rugged, and safe (QuEChERS) method using multi-walled carbon nanotubes (MWCNTs) as a reversed-dispersive solid phase extraction (r-dSPE) material combined wit... |
| 4,5-dimethyl-N-2-propen-1-yl-2-(trimethylsilyl)-3-thiophenecarboxamide |
| N-Allyl-4,5-dimethyl-2-(trimethylsilyl)thiophene-3-carboxamide |
| Latitude |
| 4,5-dimethyl-N-(prop-2-en-1-yl)-2-(trimethylsilyl)thiophene-3-carboxamide |
| 4,5-dimethyl-N-prop-2-enyl-2-trimethylsilylthiophene-3-carboxamide |
| Silthiopham |
| N-allyl-4,5-dimethyl-2-(trimethylsilyl)thiophene-3-carboxamide |
| silthiophan |
| silthiopham |