Isopropyl 4,4,4-Trifluoroacetoacetate structure
|
Common Name | Isopropyl 4,4,4-Trifluoroacetoacetate | ||
|---|---|---|---|---|
| CAS Number | 175230-50-9 | Molecular Weight | 198.14000 | |
| Density | 1.20 | Boiling Point | 42°C 28mm | |
| Molecular Formula | C7H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42°C/28mm | |
| Name | Isopropyl 4,4,4-Trifluoroacetoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.20 |
|---|---|
| Boiling Point | 42°C 28mm |
| Molecular Formula | C7H9F3O3 |
| Molecular Weight | 198.14000 |
| Flash Point | 42°C/28mm |
| Exact Mass | 198.05000 |
| PSA | 43.37000 |
| LogP | 1.45950 |
| Vapour Pressure | 2.42mmHg at 25°C |
| Index of Refraction | 1.3891 |
| InChIKey | XLBGYZLICFMDDS-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CC(=O)C(F)(F)F |
| Hazard Codes | Xi,F,Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S16-S36-S26 |
| RIDADR | 3272 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4,4-Trifluoroacetoacetic Acid Isopropyl Ester |
| MFCD00040990 |
| propan-2-yl 4,4,4-trifluoro-3-oxobutanoate |