Xanthorin structure
|
Common Name | Xanthorin | ||
|---|---|---|---|---|
| CAS Number | 17526-15-7 | Molecular Weight | 300.26 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 593.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.1±23.6 °C | |
Use of XanthorinXanrhorin is an anthraquinone agent[1]. |
| Name | 1,4,5-trihydroxy-2-methoxy-7-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Xanrhorin is an anthraquinone agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 593.8±50.0 °C at 760 mmHg |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| Flash Point | 227.1±23.6 °C |
| Exact Mass | 300.063385 |
| PSA | 104.06000 |
| LogP | 5.47 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | GLLRIXZGBQOFLM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1O)C(=O)c1cc(C)cc(O)c1C2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914690090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4,5-Trihydroxy-2-methoxy-7-methyl-9,10-anthraquinone |
| 9,10-Anthracenedione, 1,4,5-trihydroxy-2-methoxy-7-methyl- |
| 1,4,5-Trihydroxy-2-methoxy-7-methyl-9,10-anthracenedione |
| 1,4,5-Trihydroxy-2-methoxy-7-methyl-anthrachinon |
| 1,4,5-trihydroxy-2-methoxy-7-methyl-anthraquinone |