5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid
Modify Date: 2025-08-25 08:34:22
5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid structure
|
Common Name | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 175276-60-5 | Molecular Weight | 290.62200 | |
| Density | 1.486g/cm3 | Boiling Point | 400.6ºC at 760mmHg | |
| Molecular Formula | C12H6ClF3O3 | Melting Point | 188-190°C | |
| MSDS | USA | Flash Point | 196.1ºC | |
| Name | 5-(4-Chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760mmHg |
| Melting Point | 188-190°C |
| Molecular Formula | C12H6ClF3O3 |
| Molecular Weight | 290.62200 |
| Flash Point | 196.1ºC |
| Exact Mass | 289.99600 |
| PSA | 50.44000 |
| LogP | 4.31700 |
| Vapour Pressure | 3.89E-07mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | BQUIEVOFWHVZAW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)cc2)oc1C(F)(F)F |
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S45-S22 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(4-Chlorophenyl)-2-(trifluoromethyl)-3-furoic acid |
| 5-(4-CHLOROPHENYL)-2-(TRIFLUOROMETHYL)FURAN-3-CARBOXYLIC ACID |
| MFCD00275555 |