2-(4-fluorobenzylsulfonyl)acetamidoxime structure
|
Common Name | 2-(4-fluorobenzylsulfonyl)acetamidoxime | ||
|---|---|---|---|---|
| CAS Number | 175276-85-4 | Molecular Weight | 246.25900 | |
| Density | 1.44g/cm3 | Boiling Point | 534.5ºC at 760mmHg | |
| Molecular Formula | C9H11FN2O3S | Melting Point | 182 °C | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | 2-[(4-fluorophenyl)methylsulfonyl]-N'-hydroxyethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 534.5ºC at 760mmHg |
| Melting Point | 182 °C |
| Molecular Formula | C9H11FN2O3S |
| Molecular Weight | 246.25900 |
| Flash Point | 277.1ºC |
| Exact Mass | 246.04700 |
| PSA | 101.13000 |
| LogP | 2.26800 |
| Vapour Pressure | 0.0544mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | AVDGZDWBPJLTHN-UHFFFAOYSA-N |
| SMILES | NC(CS(=O)(=O)Cc1ccc(F)cc1)=NO |
| Hazard Codes | Xi:Irritant/Stench; |
|---|---|
| Risk Phrases | 25 |
| Safety Phrases | 45 |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00052932 |