Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate structure
|
Common Name | Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175277-03-9 | Molecular Weight | 315.31100 | |
| Density | 1.305 g/cm3 | Boiling Point | 374.6ºC at 760 mmHg | |
| Molecular Formula | C14H12F3NO2S | Melting Point | 87 °C | |
| MSDS | N/A | Flash Point | 180.3ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Ethyl 4-methyl-2-(4-(trifluoromethyl)phenyl)thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305 g/cm3 |
|---|---|
| Boiling Point | 374.6ºC at 760 mmHg |
| Melting Point | 87 °C |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.31100 |
| Flash Point | 180.3ºC |
| Exact Mass | 315.05400 |
| PSA | 67.43000 |
| LogP | 4.31400 |
| Vapour Pressure | 8.26E-06mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | LPIXRQSYBTUXOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2ccc(C(F)(F)F)cc2)nc1C |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S36/37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934100090 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00068104 |
| Ethyl 4-methyl-2-[4-(trifluoro-methyl)-phenyl]thiazole-5-carboxylate |
| Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]thiazole-5-carboxylate |
| Ethyl 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate |