2,6-Dichloro-4-(trifluoromethyl)-3-pyridinamine structure
|
Common Name | 2,6-Dichloro-4-(trifluoromethyl)-3-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 175277-67-5 | Molecular Weight | 231.003 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 279.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl2F3N2 | Melting Point | 45-48°C | |
| MSDS | N/A | Flash Point | 123.0±25.9 °C | |
| Name | 2,6-Dichloro-4-(trifluoromethyl)pyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.8±35.0 °C at 760 mmHg |
| Melting Point | 45-48°C |
| Molecular Formula | C6H3Cl2F3N2 |
| Molecular Weight | 231.003 |
| Flash Point | 123.0±25.9 °C |
| Exact Mass | 229.962540 |
| PSA | 38.91000 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | BVJJNBRZQVLPIC-UHFFFAOYSA-N |
| SMILES | Nc1c(C(F)(F)F)cc(Cl)nc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dichloro-4-(trifluoromethyl)pyridin-3-amine |
| MFCD00173957 |
| 2,6-Dichloro-4-(trifluoromethyl)-3-pyridinamine |