Ethyl 2-chloro-3-cyano-6-(trifluoromethyl)-pyridine-5-carboxylate structure
|
Common Name | Ethyl 2-chloro-3-cyano-6-(trifluoromethyl)-pyridine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175277-73-3 | Molecular Weight | 278.61500 | |
| Density | 1.47g/cm3 | Boiling Point | 325ºC at 760mmHg | |
| Molecular Formula | C10H6ClF3N2O2 | Melting Point | 81ºC | |
| MSDS | N/A | Flash Point | 150.3ºC | |
| Name | ethyl 6-chloro-5-cyano-2-(trifluoromethyl)pyridine-3-carboxylate |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 325ºC at 760mmHg |
| Melting Point | 81ºC |
| Molecular Formula | C10H6ClF3N2O2 |
| Molecular Weight | 278.61500 |
| Flash Point | 150.3ºC |
| Exact Mass | 278.00700 |
| PSA | 62.98000 |
| LogP | 2.80218 |
| Vapour Pressure | 0.0158mmHg at 25°C |
| InChIKey | PMDLSQHFIADYJD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C#N)c(Cl)nc1C(F)(F)F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 23-36/37/39 |
| HS Code | 2933399090 |
|
~92%
Ethyl 2-chloro-... CAS#:175277-73-3 |
| Literature: ASTRAZENECA AB Patent: WO2008/4943 A1, 2008 ; Location in patent: Page/Page column 54-55 ; WO 2008/004943 A1 |
|
~%
Ethyl 2-chloro-... CAS#:175277-73-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 10 p. 2877 - 2881 |
|
~%
Ethyl 2-chloro-... CAS#:175277-73-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 10 p. 2877 - 2881 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |