3-amino-4-(isopropylamino)benzotrifluoride
Modify Date: 2025-09-13 10:54:33
3-amino-4-(isopropylamino)benzotrifluoride structure
|
Common Name | 3-amino-4-(isopropylamino)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 175277-91-5 | Molecular Weight | 218.21900 | |
| Density | 1.225g/cm3 | Boiling Point | 276.6ºC at 760mmHg | |
| Molecular Formula | C10H13F3N2 | Melting Point | 63-65ºC | |
| MSDS | N/A | Flash Point | 121.1ºC | |
| Name | 1-N-propan-2-yl-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 276.6ºC at 760mmHg |
| Melting Point | 63-65ºC |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.21900 |
| Flash Point | 121.1ºC |
| Exact Mass | 218.10300 |
| PSA | 38.05000 |
| LogP | 3.76210 |
| InChIKey | ZNVHJHXDEMIHDL-UHFFFAOYSA-N |
| SMILES | CC(C)Nc1ccc(C(F)(F)F)cc1N |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2921590090 |
|
~%
3-amino-4-(isop... CAS#:175277-91-5 |
| Literature: WO2010/125985 A1, ; Page/Page column 251 ; |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
| N1-(1-Methylethyl)-4-(Trifluoromethyl)-1,2-Benzenediamine |
| N1-isopropyl-4-trifluoromethylbenzene-1,2-diamine |
| [2-amino-4-(trifluoromethyl)phenyl](methylethyl)amine |
| 3-amino-4-(isopropylamino)benzotrifluoride |
| MFCD00084879 |