2,3,4-Trifluorobenzene-1-sulfonyl chloride structure
|
Common Name | 2,3,4-Trifluorobenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 175278-08-7 | Molecular Weight | 230.59200 | |
| Density | 1.640 g/mL at 25 °C(lit.) | Boiling Point | 234-236 °C(lit.) | |
| Molecular Formula | C6H2ClF3O2S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 225 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,3,4-trifluorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.640 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 234-236 °C(lit.) |
| Molecular Formula | C6H2ClF3O2S |
| Molecular Weight | 230.59200 |
| Flash Point | 225 °F |
| Exact Mass | 229.94200 |
| PSA | 42.52000 |
| LogP | 3.11220 |
| Vapour Pressure | 0.0517mmHg at 25°C |
| Index of Refraction | n20/D 1.5040(lit.) |
| InChIKey | XFTDZYFHXRZLEF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(F)c(F)c1F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S39-S37-S36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
|
Efficient synthesis of Π-conjugated molecules incorporating fluorinated phenylene units through palladium-catalyzed iterative C (sp2)–H bond arylations. Abdelmalek F, et al.
Beilstein J. Org. Chem. 11(1) , 2012-2020, (2015)
|
|
|
Palladium-Catalyzed Iterative C- H Bond Arylations: Synthesis of Medium-Size Heterocycles with a Bridgehead Nitrogen Atom. Hagui W, et al.
ChemCatChem 7(21) , 3544-3554, (2015)
|
| 2,3,4-Trifluorobenzenesulfonyl chloride |
| 2,3,4,5,6-PENTAFLUOROPHENYL 2,3,4,5,6-PENTAMETHYLBENZENESULPHONATE |
| MFCD00102573 |
| 2,3,4-Trifluorobenzene-1-Sulfonyl Chloride |
| 2,3,4-Trifluorobenzenesulphonyl chloride |
| trifluorobenzenesulfonyl chloride |
| 2,3,4-trifluorophenylsulfonyl chloride |